C15H22N2O5S — CID 99978240
3-(cyclopropylsulfamoyl)-4-(3-ethoxypropylamino)benzoic acid (PubChem CID 99978240) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-4-(3-ethoxypropylamino)benzoic acid.
| Compound Name | 3-(cyclopropylsulfamoyl)-4-(3-ethoxypropylamino)benzoic acid |
|---|---|
| PubChem CID | 99978240 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-4-(3-ethoxypropylamino)benzoic acid |
| SMILES | CCOCCCNc1ccc(C(=O)O)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C15H22N2O5S/c1-2-22-9-3-8-16-13-7-4-11(15(18)19)10-14(13)23(20,21)17-12-5-6-12/h4,7,10,12,16-17H,2-3,5-6,8-9H2,1H3,(H,18,19) |
| InChIKey | NXXRAWFQHFKYNO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|