C15H24N2O6S — CID 99978870
4-(3-ethoxypropylamino)-3-(2-methoxyethylsulfamoyl)benzoic acid (PubChem CID 99978870) has the molecular formula C15H24N2O6S and a molecular weight of 360.43 g/mol. Its IUPAC name is 4-(3-ethoxypropylamino)-3-(2-methoxyethylsulfamoyl)benzoic acid.
| Compound Name | 4-(3-ethoxypropylamino)-3-(2-methoxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99978870 |
| Molecular Formula | C15H24N2O6S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-(3-ethoxypropylamino)-3-(2-methoxyethylsulfamoyl)benzoic acid |
| SMILES | CCOCCCNc1ccc(C(=O)O)cc1S(=O)(=O)NCCOC |
| InChI | InChI=1S/C15H24N2O6S/c1-3-23-9-4-7-16-13-6-5-12(15(18)19)11-14(13)24(20,21)17-8-10-22-2/h5-6,11,16-17H,3-4,7-10H2,1-2H3,(H,18,19) |
| InChIKey | AHRWANBKWDNLCQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|