C17H20N2O5S — CID 99980069
4-(3-methoxypropylamino)-3-(phenylsulfamoyl)benzoic acid (PubChem CID 99980069) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-(3-methoxypropylamino)-3-(phenylsulfamoyl)benzoic acid.
| Compound Name | 4-(3-methoxypropylamino)-3-(phenylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 99980069 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 4-(3-methoxypropylamino)-3-(phenylsulfamoyl)benzoic acid |
| SMILES | COCCCNc1ccc(C(=O)O)cc1S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-24-11-5-10-18-15-9-8-13(17(20)21)12-16(15)25(22,23)19-14-6-3-2-4-7-14/h2-4,6-9,12,18-19H,5,10-11H2,1H3,(H,20,21) |
| InChIKey | WSJUDFKZOLAOKF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|