C14H22N4O2 — CID 123312240
6-morpholin-4-yl-4-N-(oxolan-2-ylmethyl)pyridine-3,4-diamine (PubChem CID 123312240) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 6-morpholin-4-yl-4-N-(oxolan-2-ylmethyl)pyridine-3,4-diamine.
| Compound Name | 6-morpholin-4-yl-4-N-(oxolan-2-ylmethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 123312240 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 6-morpholin-4-yl-4-N-(oxolan-2-ylmethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(N2CCOCC2)cc1NCC1CCCO1 |
| InChI | InChI=1S/C14H22N4O2/c15-12-10-17-14(18-3-6-19-7-4-18)8-13(12)16-9-11-2-1-5-20-11/h8,10-11H,1-7,9,15H2,(H,16,17) |
| InChIKey | SVBXYDKQCCQYIZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |