C13H20N2O3S2 — CID 103508680
methyl 3-amino-4-methylsulfanyl-5-(oxan-2-ylmethylamino)thiophene-2-carboxylate (PubChem CID 103508680) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is methyl 3-amino-4-methylsulfanyl-5-(oxan-2-ylmethylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-methylsulfanyl-5-(oxan-2-ylmethylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103508680 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 3-amino-4-methylsulfanyl-5-(oxan-2-ylmethylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NCC2CCCCO2)c(SC)c1N |
| InChI | InChI=1S/C13H20N2O3S2/c1-17-13(16)11-9(14)10(19-2)12(20-11)15-7-8-5-3-4-6-18-8/h8,15H,3-7,14H2,1-2H3 |
| InChIKey | BBSWHOHHHNLUTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |