C11H16N2O3S — CID 80571068
methyl 2-(oxan-2-ylmethylamino)-1,3-thiazole-5-carboxylate (PubChem CID 80571068) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is methyl 2-(oxan-2-ylmethylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(oxan-2-ylmethylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80571068 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 2-(oxan-2-ylmethylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCC2CCCCO2)s1 |
| InChI | InChI=1S/C11H16N2O3S/c1-15-10(14)9-7-13-11(17-9)12-6-8-4-2-3-5-16-8/h7-8H,2-6H2,1H3,(H,12,13) |
| InChIKey | GHUNWAKCURHKFU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |