C14H19N3O3S — CID 103509892
methyl 3-amino-4-cyano-5-[ethyl(oxolan-2-ylmethyl)amino]thiophene-2-carboxylate (PubChem CID 103509892) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-5-[ethyl(oxolan-2-ylmethyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-cyano-5-[ethyl(oxolan-2-ylmethyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103509892 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 3-amino-4-cyano-5-[ethyl(oxolan-2-ylmethyl)amino]thiophene-2-carboxylate |
| SMILES | CCN(CC1CCCO1)c1sc(C(=O)OC)c(N)c1C#N |
| InChI | InChI=1S/C14H19N3O3S/c1-3-17(8-9-5-4-6-20-9)13-10(7-15)11(16)12(21-13)14(18)19-2/h9H,3-6,8,16H2,1-2H3 |
| InChIKey | VRIQFIKFXGQMHY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |