C22H21NO5 — CID 16756063
methyl 3-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]oxybenzoate (PubChem CID 16756063) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl 3-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]oxybenzoate.
| Compound Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]oxybenzoate |
|---|---|
| PubChem CID | 16756063 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | methyl 3-[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]oxybenzoate |
| SMILES | COC(=O)c1cccc(OC2CCC(N3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C22H21NO5/c1-27-22(26)14-5-4-6-17(13-14)28-16-11-9-15(10-12-16)23-20(24)18-7-2-3-8-19(18)21(23)25/h2-8,13,15-16H,9-12H2,1H3 |
| InChIKey | JMQLJBJARFZOHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|