C23H23N3O5 — CID 108874216
methyl 3-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzoate (PubChem CID 108874216) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is methyl 3-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzoate.
| Compound Name | methyl 3-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108874216 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | methyl 3-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)Nc2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)c1 |
| InChI | InChI=1S/C23H23N3O5/c1-31-22(29)14-6-5-7-15(12-14)24-23(30)25-16-10-11-18-19(13-16)21(28)26(20(18)27)17-8-3-2-4-9-17/h5-7,10-13,17H,2-4,8-9H2,1H3,(H2,24,25,30) |
| InChIKey | UYPCJYAYVLJTNX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|