C27H35N3O3 — CID 108873963
1-[1-(1-adamantyl)ethyl]-3-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)urea (PubChem CID 108873963) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-3-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)urea.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-3-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)urea |
|---|---|
| PubChem CID | 108873963 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-3-(2-cyclohexyl-1,3-dioxoisoindol-5-yl)urea |
| SMILES | CC(NC(=O)Nc1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H35N3O3/c1-16(27-13-17-9-18(14-27)11-19(10-17)15-27)28-26(33)29-20-7-8-22-23(12-20)25(32)30(24(22)31)21-5-3-2-4-6-21/h7-8,12,16-19,21H,2-6,9-11,13-15H2,1H3,(H2,28,29,33) |
| InChIKey | NKYGPGOEVWOZPJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|