C15H17N3O2S — CID 169358891
(2-cyclohexyl-1,3-dioxoisoindol-5-yl)thiourea (PubChem CID 169358891) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (2-cyclohexyl-1,3-dioxoisoindol-5-yl)thiourea.
| Compound Name | (2-cyclohexyl-1,3-dioxoisoindol-5-yl)thiourea |
|---|---|
| PubChem CID | 169358891 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2-cyclohexyl-1,3-dioxoisoindol-5-yl)thiourea |
| SMILES | NC(=S)Nc1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O |
| InChI | InChI=1S/C15H17N3O2S/c16-15(21)17-9-6-7-11-12(8-9)14(20)18(13(11)19)10-4-2-1-3-5-10/h6-8,10H,1-5H2,(H3,16,17,21) |
| InChIKey | ZGSXHQGAIBUJNZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|