C23H24N4O4 — CID 108874092
N-(3-aminophenyl)-N-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide (PubChem CID 108874092) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide.
| Compound Name | N-(3-aminophenyl)-N-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 108874092 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-(3-aminophenyl)-N-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoyl]acetamide |
| SMILES | CC(=O)N(C(=O)Nc1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)c1cccc(N)c1 |
| InChI | InChI=1S/C23H24N4O4/c1-14(28)26(18-9-5-6-15(24)12-18)23(31)25-16-10-11-19-20(13-16)22(30)27(21(19)29)17-7-3-2-4-8-17/h5-6,9-13,17H,2-4,7-8,24H2,1H3,(H,25,31) |
| InChIKey | RMBYSWXPHZHWDI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|