C15H15N3O5 — CID 108871858
N-(3-aminophenyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]acetamide (PubChem CID 108871858) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]acetamide.
| Compound Name | N-(3-aminophenyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 108871858 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-(3-aminophenyl)-N-[(3,4,5-trihydroxyphenyl)carbamoyl]acetamide |
| SMILES | CC(=O)N(C(=O)Nc1cc(O)c(O)c(O)c1)c1cccc(N)c1 |
| InChI | InChI=1S/C15H15N3O5/c1-8(19)18(11-4-2-3-9(16)5-11)15(23)17-10-6-12(20)14(22)13(21)7-10/h2-7,20-22H,16H2,1H3,(H,17,23) |
| InChIKey | MZCNGZZBYWCTFM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|