C17H16BrN3O2 — CID 108908852
N-(3-aminophenyl)-N-[[(E)-2-(4-bromophenyl)ethenyl]carbamoyl]acetamide (PubChem CID 108908852) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is N-(3-aminophenyl)-N-[[(E)-2-(4-bromophenyl)ethenyl]carbamoyl]acetamide.
| Compound Name | N-(3-aminophenyl)-N-[[(E)-2-(4-bromophenyl)ethenyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 108908852 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-(3-aminophenyl)-N-[[(E)-2-(4-bromophenyl)ethenyl]carbamoyl]acetamide |
| SMILES | CC(=O)N(C(=O)N/C=C/c1ccc(Br)cc1)c1cccc(N)c1 |
| InChI | InChI=1S/C17H16BrN3O2/c1-12(22)21(16-4-2-3-15(19)11-16)17(23)20-10-9-13-5-7-14(18)8-6-13/h2-11H,19H2,1H3,(H,20,23)/b10-9+ |
| InChIKey | XPSVJZLTYIZFNV-MDZDMXLPSA-N |
| XLogP | 3.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|