C20H25N3O5S — CID 108873974
2-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108873974) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108873974 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 2-[(2-cyclohexyl-1,3-dioxoisoindol-5-yl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)Nc1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)C(=O)O |
| InChI | InChI=1S/C20H25N3O5S/c1-29-10-9-16(19(26)27)22-20(28)21-12-7-8-14-15(11-12)18(25)23(17(14)24)13-5-3-2-4-6-13/h7-8,11,13,16H,2-6,9-10H2,1H3,(H,26,27)(H2,21,22,28) |
| InChIKey | VWDGKLDCDZJWKD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|