C18H23N3O6S — CID 108873601
2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108873601) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108873601 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-[[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)NC(CCSC)C(=O)O)cc2C1=O |
| InChI | InChI=1S/C18H23N3O6S/c1-27-8-3-7-21-15(22)12-5-4-11(10-13(12)16(21)23)19-18(26)20-14(17(24)25)6-9-28-2/h4-5,10,14H,3,6-9H2,1-2H3,(H,24,25)(H2,19,20,26) |
| InChIKey | HTCMVJJTEGWRCD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|