C24H29N3O5 — CID 108873604
1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea (PubChem CID 108873604) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea.
| Compound Name | 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
|---|---|
| PubChem CID | 108873604 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1-[1-(2-ethoxy-5-methylphenyl)ethyl]-3-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]urea |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)Nc1ccc2c(c1)C(=O)N(CCCOC)C2=O |
| InChI | InChI=1S/C24H29N3O5/c1-5-32-21-10-7-15(2)13-19(21)16(3)25-24(30)26-17-8-9-18-20(14-17)23(29)27(22(18)28)11-6-12-31-4/h7-10,13-14,16H,5-6,11-12H2,1-4H3,(H2,25,26,30) |
| InChIKey | QKYHCUGUYDOACX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|