C20H18F3N3O4 — CID 108873546
1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 108873546) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108873546 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-1,3-dioxoisoindol-5-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | COCCCN1C(=O)c2ccc(NC(=O)Nc3cccc(C(F)(F)F)c3)cc2C1=O |
| InChI | InChI=1S/C20H18F3N3O4/c1-30-9-3-8-26-17(27)15-7-6-14(11-16(15)18(26)28)25-19(29)24-13-5-2-4-12(10-13)20(21,22)23/h2,4-7,10-11H,3,8-9H2,1H3,(H2,24,25,29) |
| InChIKey | OQRJCRILOZFARF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|