C26H29NO6 — CID 11442337
methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 11442337) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11442337 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxy]-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)(C)C)C[C@H](N2C(=O)O[C@@H](c3ccccc3)[C@H]2c2ccccc2)O1 |
| InChI | InChI=1S/C26H29NO6/c1-26(2,3)33-19-15-20(24(28)30-4)31-21(16-19)27-22(17-11-7-5-8-12-17)23(32-25(27)29)18-13-9-6-10-14-18/h5-15,19,21-23H,16H2,1-4H3/t19-,21+,22+,23-/m0/s1 |
| InChIKey | WWMYNAZLAUSBTJ-IZBOUPIGSA-N |
| XLogP | 4.91 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |