C27H29NO7 — CID 10906942
dimethyl 2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]propanedioate (PubChem CID 10906942) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is dimethyl 2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 10906942 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | dimethyl 2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1C=C[C@@](C)(OC)[C@@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H29NO7/c1-27(34-4)16-15-19(20(24(29)32-2)25(30)33-3)23(27)28-21(17-11-7-5-8-12-17)22(35-26(28)31)18-13-9-6-10-14-18/h5-16,19-23H,1-4H3/t19-,21+,22-,23+,27+/m0/s1 |
| InChIKey | BAXYDVGQLNPXOK-DAPLBOTBSA-N |
| XLogP | 3.84 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|