C31H31NO7S — CID 11124578
methyl 2-(benzenesulfonyl)-2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]acetate (PubChem CID 11124578) has the molecular formula C31H31NO7S and a molecular weight of 561.66 g/mol. Its IUPAC name is methyl 2-(benzenesulfonyl)-2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-(benzenesulfonyl)-2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 11124578 |
| Molecular Formula | C31H31NO7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | methyl 2-(benzenesulfonyl)-2-[(1S,4R,5R)-4-methoxy-4-methyl-5-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)C([C@H]1C=C[C@@](C)(OC)[C@@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H31NO7S/c1-31(38-3)20-19-24(27(29(33)37-2)40(35,36)23-17-11-6-12-18-23)28(31)32-25(21-13-7-4-8-14-21)26(39-30(32)34)22-15-9-5-10-16-22/h4-20,24-28H,1-3H3/t24-,25-,26+,27?,28-,31-/m1/s1 |
| InChIKey | FXUXDLUUOLTFDZ-VBZUHPKVSA-N |
| XLogP | 4.90 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|