C17H20O6S — CID 11221899
methyl 2-[(3aS,4S,6aR)-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-4-yl]-2-(benzenesulfonyl)acetate (PubChem CID 11221899) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is methyl 2-[(3aS,4S,6aR)-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-4-yl]-2-(benzenesulfonyl)acetate.
| Compound Name | methyl 2-[(3aS,4S,6aR)-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-4-yl]-2-(benzenesulfonyl)acetate |
|---|---|
| PubChem CID | 11221899 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | methyl 2-[(3aS,4S,6aR)-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan-4-yl]-2-(benzenesulfonyl)acetate |
| SMILES | COC(=O)C([C@H]1C=C[C@H]2OC(OC)C[C@@H]12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O6S/c1-21-15-10-13-12(8-9-14(13)23-15)16(17(18)22-2)24(19,20)11-6-4-3-5-7-11/h3-9,12-16H,10H2,1-2H3/t12-,13-,14+,15?,16?/m0/s1 |
| InChIKey | ZQYNEFDPADNMTI-QJUBBFGZSA-N |
| XLogP | 1.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|