C22H24O6S2 — CID 102278597
(3aS,4S,6aR)-4-[2,2-bis(benzenesulfonyl)ethyl]-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan (PubChem CID 102278597) has the molecular formula C22H24O6S2 and a molecular weight of 448.56 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[2,2-bis(benzenesulfonyl)ethyl]-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan.
| Compound Name | (3aS,4S,6aR)-4-[2,2-bis(benzenesulfonyl)ethyl]-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan |
|---|---|
| PubChem CID | 102278597 |
| Molecular Formula | C22H24O6S2 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (3aS,4S,6aR)-4-[2,2-bis(benzenesulfonyl)ethyl]-2-methoxy-3,3a,4,6a-tetrahydro-2H-cyclopenta[b]furan |
| SMILES | COC1C[C@H]2[C@@H](CC(S(=O)(=O)c3ccccc3)S(=O)(=O)c3ccccc3)C=C[C@H]2O1 |
| InChI | InChI=1S/C22H24O6S2/c1-27-21-15-19-16(12-13-20(19)28-21)14-22(29(23,24)17-8-4-2-5-9-17)30(25,26)18-10-6-3-7-11-18/h2-13,16,19-22H,14-15H2,1H3/t16-,19+,20-,21?/m1/s1 |
| InChIKey | HMZUYZGIVFZJJA-FCPWAJFRSA-N |
| XLogP | 3.21 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|