C23H22ClNO4 — CID 10764134
methyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate (PubChem CID 10764134) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is methyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate.
| Compound Name | methyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate |
|---|---|
| PubChem CID | 10764134 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | methyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate |
| SMILES | COC(=O)[C@H](Cl)[C@@]1(N2C(=O)O[C@@H](c3ccccc3)[C@H]2c2ccccc2)CC12CC2 |
| InChI | InChI=1S/C23H22ClNO4/c1-28-20(26)19(24)23(14-22(23)12-13-22)25-17(15-8-4-2-5-9-15)18(29-21(25)27)16-10-6-3-7-11-16/h2-11,17-19H,12-14H2,1H3/t17-,18+,19+,23+/m1/s1 |
| InChIKey | QNHHMVZOJJBFDU-XQQXVUDOSA-N |
| XLogP | 4.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|