C29H26ClNO4 — CID 10767319
benzyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate (PubChem CID 10767319) has the molecular formula C29H26ClNO4 and a molecular weight of 487.98 g/mol. Its IUPAC name is benzyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate.
| Compound Name | benzyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate |
|---|---|
| PubChem CID | 10767319 |
| Molecular Formula | C29H26ClNO4 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | benzyl (2R)-2-chloro-2-[(2R)-2-[(4R,5S)-2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl]spiro[2.2]pentan-2-yl]acetate |
| SMILES | O=C(OCc1ccccc1)[C@H](Cl)[C@@]1(N2C(=O)O[C@@H](c3ccccc3)[C@H]2c2ccccc2)CC12CC2 |
| InChI | InChI=1S/C29H26ClNO4/c30-25(26(32)34-18-20-10-4-1-5-11-20)29(19-28(29)16-17-28)31-23(21-12-6-2-7-13-21)24(35-27(31)33)22-14-8-3-9-15-22/h1-15,23-25H,16-19H2/t23-,24+,25+,29+/m1/s1 |
| InChIKey | PGZWTBHLPWBDNA-SGDZTBBFSA-N |
| XLogP | 6.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|