C22H22O6 — CID 122202127
dimethyl 2-[[(3S,4S,5S)-2-oxo-4,5-diphenyloxolan-3-yl]methyl]propanedioate (PubChem CID 122202127) has the molecular formula C22H22O6 and a molecular weight of 382.41 g/mol. Its IUPAC name is dimethyl 2-[[(3S,4S,5S)-2-oxo-4,5-diphenyloxolan-3-yl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[(3S,4S,5S)-2-oxo-4,5-diphenyloxolan-3-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 122202127 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | dimethyl 2-[[(3S,4S,5S)-2-oxo-4,5-diphenyloxolan-3-yl]methyl]propanedioate |
| SMILES | COC(=O)C(C[C@@H]1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C22H22O6/c1-26-20(23)17(21(24)27-2)13-16-18(14-9-5-3-6-10-14)19(28-22(16)25)15-11-7-4-8-12-15/h3-12,16-19H,13H2,1-2H3/t16-,18+,19+/m0/s1 |
| InChIKey | JIIXRRHKLOHUTM-QXAKKESOSA-N |
| XLogP | 3.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|