C21H24O2 — CID 15305341
(3R,4R,5R)-3-(2-methylbutyl)-4,5-diphenyloxolan-2-one (PubChem CID 15305341) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (3R,4R,5R)-3-(2-methylbutyl)-4,5-diphenyloxolan-2-one.
| Compound Name | (3R,4R,5R)-3-(2-methylbutyl)-4,5-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 15305341 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3R,4R,5R)-3-(2-methylbutyl)-4,5-diphenyloxolan-2-one |
| SMILES | CCC(C)C[C@H]1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H24O2/c1-3-15(2)14-18-19(16-10-6-4-7-11-16)20(23-21(18)22)17-12-8-5-9-13-17/h4-13,15,18-20H,3,14H2,1-2H3/t15?,18-,19+,20+/m1/s1 |
| InChIKey | ZDIJJGBJUWYHQN-YVJFFELESA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |