C16H19NO2 — CID 100998680
(3R,4R,5S)-2-oxo-5-pentan-2-yl-4-phenyloxolane-3-carbonitrile (PubChem CID 100998680) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (3R,4R,5S)-2-oxo-5-pentan-2-yl-4-phenyloxolane-3-carbonitrile.
| Compound Name | (3R,4R,5S)-2-oxo-5-pentan-2-yl-4-phenyloxolane-3-carbonitrile |
|---|---|
| PubChem CID | 100998680 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (3R,4R,5S)-2-oxo-5-pentan-2-yl-4-phenyloxolane-3-carbonitrile |
| SMILES | CCCC(C)[C@@H]1OC(=O)[C@@H](C#N)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-3-7-11(2)15-14(12-8-5-4-6-9-12)13(10-17)16(18)19-15/h4-6,8-9,11,13-15H,3,7H2,1-2H3/t11?,13-,14-,15-/m0/s1 |
| InChIKey | XPEZRVOEAQUEPP-JZKRNLGJSA-N |
| XLogP | 3.27 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |