C15H16O3 — CID 10847881
(4S,5R)-4-[(3S)-hex-1-yn-3-yl]-5-phenyl-1,3-dioxolan-2-one (PubChem CID 10847881) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (4S,5R)-4-[(3S)-hex-1-yn-3-yl]-5-phenyl-1,3-dioxolan-2-one.
| Compound Name | (4S,5R)-4-[(3S)-hex-1-yn-3-yl]-5-phenyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 10847881 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (4S,5R)-4-[(3S)-hex-1-yn-3-yl]-5-phenyl-1,3-dioxolan-2-one |
| SMILES | C#C[C@H](CCC)[C@@H]1OC(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H16O3/c1-3-8-11(4-2)13-14(18-15(16)17-13)12-9-6-5-7-10-12/h2,5-7,9-11,13-14H,3,8H2,1H3/t11-,13+,14-/m1/s1 |
| InChIKey | ALPLZKBJRORPET-KWCYVHTRSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|