C17H18ClNO4 — CID 118622971
2-[(2S,3R)-2-(4-chlorophenyl)-3-ethynyl-5-oxomorpholin-4-yl]pentanoic acid (PubChem CID 118622971) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[(2S,3R)-2-(4-chlorophenyl)-3-ethynyl-5-oxomorpholin-4-yl]pentanoic acid.
| Compound Name | 2-[(2S,3R)-2-(4-chlorophenyl)-3-ethynyl-5-oxomorpholin-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 118622971 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[(2S,3R)-2-(4-chlorophenyl)-3-ethynyl-5-oxomorpholin-4-yl]pentanoic acid |
| SMILES | C#C[C@@H]1[C@H](c2ccc(Cl)cc2)OCC(=O)N1C(CCC)C(=O)O |
| InChI | InChI=1S/C17H18ClNO4/c1-3-5-14(17(21)22)19-13(4-2)16(23-10-15(19)20)11-6-8-12(18)9-7-11/h2,6-9,13-14,16H,3,5,10H2,1H3,(H,21,22)/t13-,14?,16+/m1/s1 |
| InChIKey | VLNKPYBENHUFTO-XIFZVWCKSA-N |
| XLogP | 2.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|