C24H19Cl2NO4 — CID 90357436
(2R)-2-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-phenylacetic acid (PubChem CID 90357436) has the molecular formula C24H19Cl2NO4 and a molecular weight of 456.33 g/mol. Its IUPAC name is (2R)-2-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 90357436 |
| Molecular Formula | C24H19Cl2NO4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (2R)-2-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-2-phenylacetic acid |
| SMILES | O=C(O)[C@@H](c1ccccc1)N1C(=O)CO[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2NO4/c25-18-10-6-16(7-11-18)21-23(17-8-12-19(26)13-9-17)31-14-20(28)27(21)22(24(29)30)15-4-2-1-3-5-15/h1-13,21-23H,14H2,(H,29,30)/t21-,22+,23+/m0/s1 |
| InChIKey | CIHVZMMIYHRVQW-YTFSRNRJSA-N |
| XLogP | 5.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |