C20H19Cl2NO4 — CID 144688275
4-[2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]butanoic acid (PubChem CID 144688275) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is 4-[2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]butanoic acid.
| Compound Name | 4-[2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 144688275 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-[2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)COC(c2ccc(Cl)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO4/c21-15-7-3-13(4-8-15)19-20(14-5-9-16(22)10-6-14)27-12-17(24)23(19)11-1-2-18(25)26/h3-10,19-20H,1-2,11-12H2,(H,25,26) |
| InChIKey | NGRDFOUNHJGHQW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |