C21H23Cl2NO3 — CID 90347762
(6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(2R)-1-hydroxypentan-2-yl]morpholin-3-one (PubChem CID 90347762) has the molecular formula C21H23Cl2NO3 and a molecular weight of 408.33 g/mol. Its IUPAC name is (6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(2R)-1-hydroxypentan-2-yl]morpholin-3-one.
| Compound Name | (6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(2R)-1-hydroxypentan-2-yl]morpholin-3-one |
|---|---|
| PubChem CID | 90347762 |
| Molecular Formula | C21H23Cl2NO3 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(2R)-1-hydroxypentan-2-yl]morpholin-3-one |
| SMILES | CCC[C@H](CO)N1C(=O)CO[C@H](c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2NO3/c1-2-4-18(12-25)24-19(26)13-27-21(15-5-3-6-17(23)11-15)20(24)14-7-9-16(22)10-8-14/h3,5-11,18,20-21,25H,2,4,12-13H2,1H3/t18-,20?,21-/m1/s1 |
| InChIKey | APSDGKDTEPIERV-TXZDUHFLSA-N |
| XLogP | 4.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |