C21H23Cl2NO2S — CID 123959428
6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(2-sulfanylpentan-3-yl)morpholin-3-one (PubChem CID 123959428) has the molecular formula C21H23Cl2NO2S and a molecular weight of 424.39 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(2-sulfanylpentan-3-yl)morpholin-3-one.
| Compound Name | 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(2-sulfanylpentan-3-yl)morpholin-3-one |
|---|---|
| PubChem CID | 123959428 |
| Molecular Formula | C21H23Cl2NO2S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-(2-sulfanylpentan-3-yl)morpholin-3-one |
| SMILES | CCC(C(C)S)N1C(=O)COC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2NO2S/c1-3-18(13(2)27)24-19(25)12-26-21(15-5-4-6-17(23)11-15)20(24)14-7-9-16(22)10-8-14/h4-11,13,18,20-21,27H,3,12H2,1-2H3 |
| InChIKey | IQNWAPLQGSPDQO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|