C22H30O2Sn — CID 71346298
2,2-dibutyl-4,5-diphenyl-1,3,2-dioxastannolane (PubChem CID 71346298) has the molecular formula C22H30O2Sn and a molecular weight of 445.19 g/mol. Its IUPAC name is 2,2-dibutyl-4,5-diphenyl-1,3,2-dioxastannolane.
| Compound Name | 2,2-dibutyl-4,5-diphenyl-1,3,2-dioxastannolane |
|---|---|
| PubChem CID | 71346298 |
| Molecular Formula | C22H30O2Sn |
| Molecular Weight | 445.19 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2,2-dibutyl-4,5-diphenyl-1,3,2-dioxastannolane |
| SMILES | CCCC[Sn]1(CCCC)OC(c2ccccc2)C(c2ccccc2)O1 |
| InChI | InChI=1S/C14H12O2.2C4H9.Sn/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;2*1-3-4-2;/h1-10,13-14H;2*1,3-4H2,2H3;/q-2;;;+2 |
| InChIKey | XFKDOJLLZIITQF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.19 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |