C14H23NO4SSn — CID 16683167
2,2-dibutyl-5-pyridin-2-yl-1,3,4,2-dioxathiastannolane 4,4-dioxide (PubChem CID 16683167) has the molecular formula C14H23NO4SSn and a molecular weight of 420.12 g/mol. Its IUPAC name is 2,2-dibutyl-5-pyridin-2-yl-1,3,4,2-dioxathiastannolane 4,4-dioxide.
| Compound Name | 2,2-dibutyl-5-pyridin-2-yl-1,3,4,2-dioxathiastannolane 4,4-dioxide |
|---|---|
| PubChem CID | 16683167 |
| Molecular Formula | C14H23NO4SSn |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2,2-dibutyl-5-pyridin-2-yl-1,3,4,2-dioxathiastannolane 4,4-dioxide |
| SMILES | CCCC[Sn]1(CCCC)OC(c2ccccn2)S(=O)(=O)O1 |
| InChI | InChI=1S/C6H6NO4S.2C4H9.Sn/c8-6(12(9,10)11)5-3-1-2-4-7-5;2*1-3-4-2;/h1-4,6H,(H,9,10,11);2*1,3-4H2,2H3;/q-1;;;+2/p-1 |
| InChIKey | IQIDREHHBOIYBU-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |