C15H15NO — CID 101468002
2-[(2S,3S)-3-ethyl-3-phenyloxiran-2-yl]pyridine (PubChem CID 101468002) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(2S,3S)-3-ethyl-3-phenyloxiran-2-yl]pyridine.
| Compound Name | 2-[(2S,3S)-3-ethyl-3-phenyloxiran-2-yl]pyridine |
|---|---|
| PubChem CID | 101468002 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-[(2S,3S)-3-ethyl-3-phenyloxiran-2-yl]pyridine |
| SMILES | CC[C@@]1(c2ccccc2)O[C@H]1c1ccccn1 |
| InChI | InChI=1S/C15H15NO/c1-2-15(12-8-4-3-5-9-12)14(17-15)13-10-6-7-11-16-13/h3-11,14H,2H2,1H3/t14-,15-/m0/s1 |
| InChIKey | DLVLBHGSOKGPBK-GJZGRUSLSA-N |
| XLogP | 3.46 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|