C21H18O — CID 15499229
(2R,3S)-2-benzyl-2,3-diphenyloxirane (PubChem CID 15499229) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3S)-2-benzyl-2,3-diphenyloxirane.
| Compound Name | (2R,3S)-2-benzyl-2,3-diphenyloxirane |
|---|---|
| PubChem CID | 15499229 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2R,3S)-2-benzyl-2,3-diphenyloxirane |
| SMILES | c1ccc(C[C@]2(c3ccccc3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18O/c1-4-10-17(11-5-1)16-21(19-14-8-3-9-15-19)20(22-21)18-12-6-2-7-13-18/h1-15,20H,16H2/t20-,21+/m0/s1 |
| InChIKey | IOZUXXFRJINMRY-LEWJYISDSA-N |
| XLogP | 4.90 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|