C14H13NO2 — CID 54339470
[(2S,3S)-2-phenyl-3-pyridin-3-yloxiran-2-yl]methanol (PubChem CID 54339470) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is [(2S,3S)-2-phenyl-3-pyridin-3-yloxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-2-phenyl-3-pyridin-3-yloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 54339470 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | [(2S,3S)-2-phenyl-3-pyridin-3-yloxiran-2-yl]methanol |
| SMILES | OC[C@]1(c2ccccc2)O[C@H]1c1cccnc1 |
| InChI | InChI=1S/C14H13NO2/c16-10-14(12-6-2-1-3-7-12)13(17-14)11-5-4-8-15-9-11/h1-9,13,16H,10H2/t13-,14+/m0/s1 |
| InChIKey | TXXHPOVRWWZSBR-UONOGXRCSA-N |
| XLogP | 2.04 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|