C15H24O3Sn — CID 124629679
(5R)-3,3-dibutyl-5-phenyl-1,2,4,3-trioxastannolane (PubChem CID 124629679) has the molecular formula C15H24O3Sn and a molecular weight of 371.07 g/mol. Its IUPAC name is (5R)-3,3-dibutyl-5-phenyl-1,2,4,3-trioxastannolane.
| Compound Name | (5R)-3,3-dibutyl-5-phenyl-1,2,4,3-trioxastannolane |
|---|---|
| PubChem CID | 124629679 |
| Molecular Formula | C15H24O3Sn |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (5R)-3,3-dibutyl-5-phenyl-1,2,4,3-trioxastannolane |
| SMILES | CCCC[Sn]1(CCCC)OO[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C7H7O3.2C4H9.Sn/c8-7(10-9)6-4-2-1-3-5-6;2*1-3-4-2;/h1-5,7,9H;2*1,3-4H2,2H3;/q-1;;;+2/p-1/t7-;;;/m0.../s1 |
| InChIKey | CYWIWJVLQHDEBA-QTPLPEIMSA-M |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|