C16H26O2Sn — CID 16695949
2,2-dibutyl-4-phenyl-1,3,2-dioxastannolane (PubChem CID 16695949) has the molecular formula C16H26O2Sn and a molecular weight of 369.09 g/mol. Its IUPAC name is 2,2-dibutyl-4-phenyl-1,3,2-dioxastannolane.
| Compound Name | 2,2-dibutyl-4-phenyl-1,3,2-dioxastannolane |
|---|---|
| PubChem CID | 16695949 |
| Molecular Formula | C16H26O2Sn |
| Molecular Weight | 369.09 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2,2-dibutyl-4-phenyl-1,3,2-dioxastannolane |
| SMILES | CCCC[Sn]1(CCCC)OCC(c2ccccc2)O1 |
| InChI | InChI=1S/C8H8O2.2C4H9.Sn/c9-6-8(10)7-4-2-1-3-5-7;2*1-3-4-2;/h1-5,8H,6H2;2*1,3-4H2,2H3;/q-2;;;+2 |
| InChIKey | BGQGOSISNLANIM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |