C16H26S2Sn — CID 71397911
2,2-dibutyl-4-phenyl-1,3,2-dithiastannolane (PubChem CID 71397911) has the molecular formula C16H26S2Sn and a molecular weight of 401.23 g/mol. Its IUPAC name is 2,2-dibutyl-4-phenyl-1,3,2-dithiastannolane.
| Compound Name | 2,2-dibutyl-4-phenyl-1,3,2-dithiastannolane |
|---|---|
| PubChem CID | 71397911 |
| Molecular Formula | C16H26S2Sn |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2,2-dibutyl-4-phenyl-1,3,2-dithiastannolane |
| SMILES | CCCC[Sn]1(CCCC)SCC(c2ccccc2)S1 |
| InChI | InChI=1S/C8H10S2.2C4H9.Sn/c9-6-8(10)7-4-2-1-3-5-7;2*1-3-4-2;/h1-5,8-10H,6H2;2*1,3-4H2,2H3;/q;;;+2/p-2 |
| InChIKey | RIKFKFTZJUCCQO-UHFFFAOYSA-L |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |