C19H17NO2 — CID 23465620
3-(4-oxo-2-phenyl-2,3-dihydrochromen-3-yl)butanenitrile (PubChem CID 23465620) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-(4-oxo-2-phenyl-2,3-dihydrochromen-3-yl)butanenitrile.
| Compound Name | 3-(4-oxo-2-phenyl-2,3-dihydrochromen-3-yl)butanenitrile |
|---|---|
| PubChem CID | 23465620 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 3-(4-oxo-2-phenyl-2,3-dihydrochromen-3-yl)butanenitrile |
| SMILES | CC(CC#N)C1C(=O)c2ccccc2OC1c1ccccc1 |
| InChI | InChI=1S/C19H17NO2/c1-13(11-12-20)17-18(21)15-9-5-6-10-16(15)22-19(17)14-7-3-2-4-8-14/h2-10,13,17,19H,11H2,1H3 |
| InChIKey | QJSSWJKKVXNFFN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |