C19H19NO2 — CID 56607953
2-phenyl-3-(propan-2-yliminomethyl)-2,3-dihydrochromen-4-one (PubChem CID 56607953) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-phenyl-3-(propan-2-yliminomethyl)-2,3-dihydrochromen-4-one.
| Compound Name | 2-phenyl-3-(propan-2-yliminomethyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 56607953 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-phenyl-3-(propan-2-yliminomethyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)/N=C/C1C(=O)c2ccccc2OC1c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-13(2)20-12-16-18(21)15-10-6-7-11-17(15)22-19(16)14-8-4-3-5-9-14/h3-13,16,19H,1-2H3/b20-12+ |
| InChIKey | GLQFNOZEYQOOFD-UDWIEESQSA-N |
| XLogP | 4.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|