C24H27NO4 — CID 15505443
(4S,5R)-3-[(1S,2R,3R)-3-hydroxy-2-methoxy-2-methyl-3-prop-2-enylcyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 15505443) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (4S,5R)-3-[(1S,2R,3R)-3-hydroxy-2-methoxy-2-methyl-3-prop-2-enylcyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(1S,2R,3R)-3-hydroxy-2-methoxy-2-methyl-3-prop-2-enylcyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15505443 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (4S,5R)-3-[(1S,2R,3R)-3-hydroxy-2-methoxy-2-methyl-3-prop-2-enylcyclobutyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@]1(O)C[C@H](N2C(=O)O[C@H](c3ccccc3)[C@@H]2c2ccccc2)[C@@]1(C)OC |
| InChI | InChI=1S/C24H27NO4/c1-4-15-24(27)16-19(23(24,2)28-3)25-20(17-11-7-5-8-12-17)21(29-22(25)26)18-13-9-6-10-14-18/h4-14,19-21,27H,1,15-16H2,2-3H3/t19-,20-,21+,23+,24+/m0/s1 |
| InChIKey | KDPNUPANQGBJDC-BRUFLCKMSA-N |
| XLogP | 4.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|