C25H28O3 — CID 166439737
methyl (1R,4S)-4-methoxy-1,8-diphenylspiro[4.5]dec-2-ene-3-carboxylate (PubChem CID 166439737) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl (1R,4S)-4-methoxy-1,8-diphenylspiro[4.5]dec-2-ene-3-carboxylate.
| Compound Name | methyl (1R,4S)-4-methoxy-1,8-diphenylspiro[4.5]dec-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 166439737 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl (1R,4S)-4-methoxy-1,8-diphenylspiro[4.5]dec-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccccc2)C2(CCC(c3ccccc3)CC2)[C@@H]1OC |
| InChI | InChI=1S/C25H28O3/c1-27-23-21(24(26)28-2)17-22(20-11-7-4-8-12-20)25(23)15-13-19(14-16-25)18-9-5-3-6-10-18/h3-12,17,19,22-23H,13-16H2,1-2H3/t19?,22-,23-,25?/m1/s1 |
| InChIKey | GTVYVZBUSHCGNS-JPCXVYRLSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |