C17H22INO4Si — CID 142675439
methyl 5-[dimethyl(phenyl)silyl]-6a-(iodomethyl)-2-oxo-3a,4,5,6-tetrahydro-3H-cyclopenta[d][1,3]oxazole-6-carboxylate (PubChem CID 142675439) has the molecular formula C17H22INO4Si and a molecular weight of 459.36 g/mol. Its IUPAC name is methyl 5-[dimethyl(phenyl)silyl]-6a-(iodomethyl)-2-oxo-3a,4,5,6-tetrahydro-3H-cyclopenta[d][1,3]oxazole-6-carboxylate.
| Compound Name | methyl 5-[dimethyl(phenyl)silyl]-6a-(iodomethyl)-2-oxo-3a,4,5,6-tetrahydro-3H-cyclopenta[d][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 142675439 |
| Molecular Formula | C17H22INO4Si |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | methyl 5-[dimethyl(phenyl)silyl]-6a-(iodomethyl)-2-oxo-3a,4,5,6-tetrahydro-3H-cyclopenta[d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)C1C([Si](C)(C)c2ccccc2)CC2NC(=O)OC21CI |
| InChI | InChI=1S/C17H22INO4Si/c1-22-15(20)14-12(24(2,3)11-7-5-4-6-8-11)9-13-17(14,10-18)23-16(21)19-13/h4-8,12-14H,9-10H2,1-3H3,(H,19,21) |
| InChIKey | LSSJLEYJUKGEIS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|