C16H16O4S — CID 124536779
methyl (1R,3R,6R,7S,9S)-5-oxo-6-phenylsulfanyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 124536779) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl (1R,3R,6R,7S,9S)-5-oxo-6-phenylsulfanyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | methyl (1R,3R,6R,7S,9S)-5-oxo-6-phenylsulfanyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 124536779 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl (1R,3R,6R,7S,9S)-5-oxo-6-phenylsulfanyl-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]3OC(=O)[C@@]1(Sc1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C16H16O4S/c1-19-14(17)13-9-7-11-12(8-9)20-15(18)16(11,13)21-10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3/t9-,11+,12-,13+,16-/m1/s1 |
| InChIKey | GNMPAHASEAWKNU-WCXATKCASA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |