C23H26O4S2 — CID 14630144
methyl (3aS,4S,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 14630144) has the molecular formula C23H26O4S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is methyl (3aS,4S,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aS,4S,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 14630144 |
| Molecular Formula | C23H26O4S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | methyl (3aS,4S,5S,6S,7aS)-2,2-dimethyl-4,6-bis(phenylsulfanyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](Sc2ccccc2)[C@H]2OC(C)(C)O[C@H]2C[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C23H26O4S2/c1-23(2)26-17-14-18(28-15-10-6-4-7-11-15)19(22(24)25-3)21(20(17)27-23)29-16-12-8-5-9-13-16/h4-13,17-21H,14H2,1-3H3/t17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | YSSLIGAPWQTDGN-SXYSDOLCSA-N |
| XLogP | 5.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |