C16H19NO4 — CID 10108224
methyl (8S,9S,10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8-carboxylate (PubChem CID 10108224) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl (8S,9S,10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8-carboxylate.
| Compound Name | methyl (8S,9S,10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8-carboxylate |
|---|---|
| PubChem CID | 10108224 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl (8S,9S,10S,14R)-12,12-dimethyl-11,13-dioxa-1-azatetracyclo[7.6.0.02,7.010,14]pentadeca-2,4,6-triene-8-carboxylate |
| SMILES | COC(=O)[C@H]1c2ccccc2N2C[C@H]3OC(C)(C)O[C@H]3[C@H]12 |
| InChI | InChI=1S/C16H19NO4/c1-16(2)20-11-8-17-10-7-5-4-6-9(10)12(15(18)19-3)13(17)14(11)21-16/h4-7,11-14H,8H2,1-3H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | YWIGVKHAQGKFFZ-ZOBORPQBSA-N |
| XLogP | 1.67 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |